C26H32F3NO3 — CID 135079538
(1S)-1-(3-benzyl-4,7-dimethyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-2-yl)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethanol (PubChem CID 135079538) has the molecular formula C26H32F3NO3 and a molecular weight of 463.54 g/mol. Its IUPAC name is (1S)-1-(3-benzyl-4,7-dimethyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-2-yl)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethanol.
| Compound Name | (1S)-1-(3-benzyl-4,7-dimethyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-2-yl)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 135079538 |
| Molecular Formula | C26H32F3NO3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | (1S)-1-(3-benzyl-4,7-dimethyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-2-yl)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethanol |
| SMILES | COc1ccc([C@](O)(C2OC3CC(C)CCC3C(C)N2Cc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H32F3NO3/c1-17-9-14-22-18(2)30(16-19-7-5-4-6-8-19)24(33-23(22)15-17)25(31,26(27,28)29)20-10-12-21(32-3)13-11-20/h4-8,10-13,17-18,22-24,31H,9,14-16H2,1-3H3/t17?,18?,22?,23?,24?,25-/m0/s1 |
| InChIKey | JSXCVDBXABFMLK-YRFAIMDLSA-N |
| XLogP | 5.50 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |