C22H40O2Si — CID 135079746
1-cyclohexylprop-2-enoxy-[(2E,5E)-hepta-2,5-dien-4-yl]oxy-di(propan-2-yl)silane (PubChem CID 135079746) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is 1-cyclohexylprop-2-enoxy-[(2E,5E)-hepta-2,5-dien-4-yl]oxy-di(propan-2-yl)silane.
| Compound Name | 1-cyclohexylprop-2-enoxy-[(2E,5E)-hepta-2,5-dien-4-yl]oxy-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 135079746 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | 1-cyclohexylprop-2-enoxy-[(2E,5E)-hepta-2,5-dien-4-yl]oxy-di(propan-2-yl)silane |
| SMILES | C=CC(O[Si](OC(/C=C/C)/C=C/C)(C(C)C)C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C22H40O2Si/c1-8-14-21(15-9-2)23-25(18(4)5,19(6)7)24-22(10-3)20-16-12-11-13-17-20/h8-10,14-15,18-22H,3,11-13,16-17H2,1-2,4-7H3/b14-8+,15-9+ |
| InChIKey | ANWDVIYGWLORRS-VOMDNODZSA-N |
| XLogP | 6.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|