C43H51BF4O3Si — CID 135079827
[(3R,4R)-5-methyl-3-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]hept-1-en-4-yl]oxy-tri(propan-2-yl)silane (PubChem CID 135079827) has the molecular formula C43H51BF4O3Si and a molecular weight of 730.77 g/mol. Its IUPAC name is [(3R,4R)-5-methyl-3-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]hept-1-en-4-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(3R,4R)-5-methyl-3-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]hept-1-en-4-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 135079827 |
| Molecular Formula | C43H51BF4O3Si |
| Molecular Weight | 730.77 g/mol |
| Exact Mass | 730.36 |
| IUPAC Name | [(3R,4R)-5-methyl-3-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]hept-1-en-4-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C=C[C@@H](B1OC(c2ccc(F)cc2)(c2ccc(F)cc2)C(c2ccc(F)cc2)(c2ccc(F)cc2)O1)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C(C)CC |
| InChI | InChI=1S/C43H51BF4O3Si/c1-10-31(9)41(49-52(28(3)4,29(5)6)30(7)8)40(11-2)44-50-42(32-12-20-36(45)21-13-32,33-14-22-37(46)23-15-33)43(51-44,34-16-24-38(47)25-17-34)35-18-26-39(48)27-19-35/h11-31,40-41H,2,10H2,1,3-9H3/t31?,40-,41+/m1/s1 |
| InChIKey | WQZIFXQNQXEXCE-XAZUOHAESA-N |
| XLogP | 12.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.77 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|