C29H47N5O6SSi2 — CID 135079897
[2-amino-9-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl] 4-methylbenzenesulfonate (PubChem CID 135079897) has the molecular formula C29H47N5O6SSi2 and a molecular weight of 649.96 g/mol. Its IUPAC name is [2-amino-9-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl] 4-methylbenzenesulfonate.
| Compound Name | [2-amino-9-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135079897 |
| Molecular Formula | C29H47N5O6SSi2 |
| Molecular Weight | 649.96 g/mol |
| Exact Mass | 649.28 |
| IUPAC Name | [2-amino-9-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2nc(N)nc3c2ncn3[C@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O2)cc1 |
| InChI | InChI=1S/C29H47N5O6SSi2/c1-19-12-14-20(15-13-19)41(35,36)39-26-24-25(32-27(30)33-26)34(18-31-24)23-16-21(40-43(10,11)29(5,6)7)22(38-23)17-37-42(8,9)28(2,3)4/h12-15,18,21-23H,16-17H2,1-11H3,(H2,30,32,33)/t21-,22-,23-/m1/s1 |
| InChIKey | QIUKQUCCZADOGA-DNVJHFABSA-N |
| XLogP | 6.18 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.96 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|