About methyl (3E)-3-trimethylsilyloxyhepta-3,6-dienoate
methyl (3E)-3-trimethylsilyloxyhepta-3,6-dienoate (PubChem CID 135079957) has the molecular formula C11H20O3Si
and a molecular weight of 228.36 g/mol. Its IUPAC name is methyl (3E)-3-trimethylsilyloxyhepta-3,6-dienoate.
Molecular Properties
| Compound Name | methyl (3E)-3-trimethylsilyloxyhepta-3,6-dienoate |
| PubChem CID | 135079957 |
| Molecular Formula | C11H20O3Si |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | methyl (3E)-3-trimethylsilyloxyhepta-3,6-dienoate |
| SMILES | C=CC/C=C(\CC(=O)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C11H20O3Si/c1-6-7-8-10(9-11(12)13-2)14-15(3,4)5/h6,8H,1,7,9H2,2-5H3/b10-8+ |
| InChIKey | YNDDSDQAZRTNQV-CSKARUKUSA-N |
| XLogP | 2.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (3E)-3-trimethylsilyloxyhepta-3,6-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3E)-3-trimethylsilyloxyhepta-3,6-dienoate?
The IUPAC name of methyl (3E)-3-trimethylsilyloxyhepta-3,6-dienoate (CID 135079957) is methyl (3E)-3-trimethylsilyloxyhepta-3,6-dienoate.
What is the SMILES notation for methyl (3E)-3-trimethylsilyloxyhepta-3,6-dienoate?
The canonical SMILES for methyl (3E)-3-trimethylsilyloxyhepta-3,6-dienoate is C=CC/C=C(\CC(=O)OC)O[Si](C)(C)C.
What is the InChIKey of methyl (3E)-3-trimethylsilyloxyhepta-3,6-dienoate?
The InChIKey is YNDDSDQAZRTNQV-CSKARUKUSA-N. The full InChI is InChI=1S/C11H20O3Si/c1-6-7-8-10(9-11(12)13-2)14-15(3,4)5/h6,8H,1,7,9H2,2-5H3/b10-8+.
What are the key properties of methyl (3E)-3-trimethylsilyloxyhepta-3,6-dienoate?
methyl (3E)-3-trimethylsilyloxyhepta-3,6-dienoate has a molecular weight of 228.36 g/mol, XLogP of 2.86, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3E)-3-trimethylsilyloxyhepta-3,6-dienoate is sourced from PubChem (CID 135079957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).