C14H20O4 — CID 135079967
dimethyl 2-[(2E,4E)-hexa-2,4-dienyl]-2-prop-2-enylpropanedioate (PubChem CID 135079967) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is dimethyl 2-[(2E,4E)-hexa-2,4-dienyl]-2-prop-2-enylpropanedioate.
| Compound Name | dimethyl 2-[(2E,4E)-hexa-2,4-dienyl]-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 135079967 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | dimethyl 2-[(2E,4E)-hexa-2,4-dienyl]-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(C/C=C/C=C/C)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C14H20O4/c1-5-7-8-9-11-14(10-6-2,12(15)17-3)13(16)18-4/h5-9H,2,10-11H2,1,3-4H3/b7-5+,9-8+ |
| InChIKey | FJJJBAJNKHXQSP-ZIRGRKGMSA-N |
| XLogP | 2.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|