C45H53BF4O3Si — CID 135079993
[(1R,2R)-1-cyclohexyl-2-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]but-3-enoxy]-tri(propan-2-yl)silane (PubChem CID 135079993) has the molecular formula C45H53BF4O3Si and a molecular weight of 756.81 g/mol. Its IUPAC name is [(1R,2R)-1-cyclohexyl-2-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]but-3-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(1R,2R)-1-cyclohexyl-2-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]but-3-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 135079993 |
| Molecular Formula | C45H53BF4O3Si |
| Molecular Weight | 756.81 g/mol |
| Exact Mass | 756.38 |
| IUPAC Name | [(1R,2R)-1-cyclohexyl-2-[4,4,5,5-tetrakis(4-fluorophenyl)-1,3,2-dioxaborolan-2-yl]but-3-enoxy]-tri(propan-2-yl)silane |
| SMILES | C=C[C@@H](B1OC(c2ccc(F)cc2)(c2ccc(F)cc2)C(c2ccc(F)cc2)(c2ccc(F)cc2)O1)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C45H53BF4O3Si/c1-8-42(43(33-12-10-9-11-13-33)51-54(30(2)3,31(4)5)32(6)7)46-52-44(34-14-22-38(47)23-15-34,35-16-24-39(48)25-17-35)45(53-46,36-18-26-40(49)27-19-36)37-20-28-41(50)29-21-37/h8,14-33,42-43H,1,9-13H2,2-7H3/t42-,43+/m1/s1 |
| InChIKey | YROSSKJBINWTDP-QAZBPYKKSA-N |
| XLogP | 12.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.81 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|