About 3-(3-bromophenyl)-2H-1,4-benzothiazine
3-(3-bromophenyl)-2H-1,4-benzothiazine (PubChem CID 135080087) has the molecular formula C14H10BrNS
and a molecular weight of 304.21 g/mol. Its IUPAC name is 3-(3-bromophenyl)-2H-1,4-benzothiazine.
Molecular Properties
| Compound Name | 3-(3-bromophenyl)-2H-1,4-benzothiazine |
| PubChem CID | 135080087 |
| Molecular Formula | C14H10BrNS |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 3-(3-bromophenyl)-2H-1,4-benzothiazine |
| SMILES | Brc1cccc(C2=Nc3ccccc3SC2)c1 |
| InChI | InChI=1S/C14H10BrNS/c15-11-5-3-4-10(8-11)13-9-17-14-7-2-1-6-12(14)16-13/h1-8H,9H2 |
| InChIKey | ABUIRQMJZYTVSZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3-bromophenyl)-2H-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromophenyl)-2H-1,4-benzothiazine?
The IUPAC name of 3-(3-bromophenyl)-2H-1,4-benzothiazine (CID 135080087) is 3-(3-bromophenyl)-2H-1,4-benzothiazine.
What is the SMILES notation for 3-(3-bromophenyl)-2H-1,4-benzothiazine?
The canonical SMILES for 3-(3-bromophenyl)-2H-1,4-benzothiazine is Brc1cccc(C2=Nc3ccccc3SC2)c1.
What is the InChIKey of 3-(3-bromophenyl)-2H-1,4-benzothiazine?
The InChIKey is ABUIRQMJZYTVSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrNS/c15-11-5-3-4-10(8-11)13-9-17-14-7-2-1-6-12(14)16-13/h1-8H,9H2.
What are the key properties of 3-(3-bromophenyl)-2H-1,4-benzothiazine?
3-(3-bromophenyl)-2H-1,4-benzothiazine has a molecular weight of 304.21 g/mol, XLogP of 4.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromophenyl)-2H-1,4-benzothiazine is sourced from PubChem (CID 135080087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).