C21H34O4 — CID 135080120
4,4,9,9-tetrakis(methoxymethyl)-2-methyldodec-1-en-6,11-diyne (PubChem CID 135080120) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is 4,4,9,9-tetrakis(methoxymethyl)-2-methyldodec-1-en-6,11-diyne.
| Compound Name | 4,4,9,9-tetrakis(methoxymethyl)-2-methyldodec-1-en-6,11-diyne |
|---|---|
| PubChem CID | 135080120 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 4,4,9,9-tetrakis(methoxymethyl)-2-methyldodec-1-en-6,11-diyne |
| SMILES | C#CCC(CC#CCC(COC)(COC)CC(=C)C)(COC)COC |
| InChI | InChI=1S/C21H34O4/c1-8-11-20(15-22-4,16-23-5)12-9-10-13-21(17-24-6,18-25-7)14-19(2)3/h1H,2,11-18H2,3-7H3 |
| InChIKey | BNMLYIZZXGQWCD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|