About (NE)-N-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydroxylamine
(NE)-N-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydroxylamine (PubChem CID 135080134) has the molecular formula C7H9N3O3
and a molecular weight of 183.17 g/mol. Its IUPAC name is (NE)-N-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydroxylamine |
| PubChem CID | 135080134 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | (NE)-N-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydroxylamine |
| SMILES | COc1ncc(/C=N/O)c(OC)n1 |
| InChI | InChI=1S/C7H9N3O3/c1-12-6-5(4-9-11)3-8-7(10-6)13-2/h3-4,11H,1-2H3/b9-4+ |
| InChIKey | NNXSZNWYYYRPGV-RUDMXATFSA-N |
| XLogP | 0.30 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydroxylamine?
The IUPAC name of (NE)-N-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydroxylamine (CID 135080134) is (NE)-N-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydroxylamine is COc1ncc(/C=N/O)c(OC)n1.
What is the InChIKey of (NE)-N-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydroxylamine?
The InChIKey is NNXSZNWYYYRPGV-RUDMXATFSA-N. The full InChI is InChI=1S/C7H9N3O3/c1-12-6-5(4-9-11)3-8-7(10-6)13-2/h3-4,11H,1-2H3/b9-4+.
What are the key properties of (NE)-N-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydroxylamine?
(NE)-N-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydroxylamine has a molecular weight of 183.17 g/mol, XLogP of 0.30, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[(2,4-dimethoxypyrimidin-5-yl)methylidene]hydroxylamine is sourced from PubChem (CID 135080134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).