About (5Z)-5-(2,2-dimethylpropylidene)-3-methyl-1,3-oxazolidin-2-one
(5Z)-5-(2,2-dimethylpropylidene)-3-methyl-1,3-oxazolidin-2-one (PubChem CID 135080346) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is (5Z)-5-(2,2-dimethylpropylidene)-3-methyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (5Z)-5-(2,2-dimethylpropylidene)-3-methyl-1,3-oxazolidin-2-one |
| PubChem CID | 135080346 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (5Z)-5-(2,2-dimethylpropylidene)-3-methyl-1,3-oxazolidin-2-one |
| SMILES | CN1C/C(=C/C(C)(C)C)OC1=O |
| InChI | InChI=1S/C9H15NO2/c1-9(2,3)5-7-6-10(4)8(11)12-7/h5H,6H2,1-4H3/b7-5- |
| InChIKey | FIFCLZLVGWMAMB-ALCCZGGFSA-N |
| XLogP | 2.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5Z)-5-(2,2-dimethylpropylidene)-3-methyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-(2,2-dimethylpropylidene)-3-methyl-1,3-oxazolidin-2-one?
The IUPAC name of (5Z)-5-(2,2-dimethylpropylidene)-3-methyl-1,3-oxazolidin-2-one (CID 135080346) is (5Z)-5-(2,2-dimethylpropylidene)-3-methyl-1,3-oxazolidin-2-one.
What is the SMILES notation for (5Z)-5-(2,2-dimethylpropylidene)-3-methyl-1,3-oxazolidin-2-one?
The canonical SMILES for (5Z)-5-(2,2-dimethylpropylidene)-3-methyl-1,3-oxazolidin-2-one is CN1C/C(=C/C(C)(C)C)OC1=O.
What is the InChIKey of (5Z)-5-(2,2-dimethylpropylidene)-3-methyl-1,3-oxazolidin-2-one?
The InChIKey is FIFCLZLVGWMAMB-ALCCZGGFSA-N. The full InChI is InChI=1S/C9H15NO2/c1-9(2,3)5-7-6-10(4)8(11)12-7/h5H,6H2,1-4H3/b7-5-.
What are the key properties of (5Z)-5-(2,2-dimethylpropylidene)-3-methyl-1,3-oxazolidin-2-one?
(5Z)-5-(2,2-dimethylpropylidene)-3-methyl-1,3-oxazolidin-2-one has a molecular weight of 169.22 g/mol, XLogP of 2.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-(2,2-dimethylpropylidene)-3-methyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 135080346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).