About 1-tert-butyl-4-(3,3,3-trifluoroprop-1-en-2-yloxy)cyclohexane
1-tert-butyl-4-(3,3,3-trifluoroprop-1-en-2-yloxy)cyclohexane (PubChem CID 135080583) has the molecular formula C13H21F3O
and a molecular weight of 250.30 g/mol. Its IUPAC name is 1-tert-butyl-4-(3,3,3-trifluoroprop-1-en-2-yloxy)cyclohexane.
Molecular Properties
| Compound Name | 1-tert-butyl-4-(3,3,3-trifluoroprop-1-en-2-yloxy)cyclohexane |
| PubChem CID | 135080583 |
| Molecular Formula | C13H21F3O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-tert-butyl-4-(3,3,3-trifluoroprop-1-en-2-yloxy)cyclohexane |
| SMILES | C=C(OC1CCC(C(C)(C)C)CC1)C(F)(F)F |
| InChI | InChI=1S/C13H21F3O/c1-9(13(14,15)16)17-11-7-5-10(6-8-11)12(2,3)4/h10-11H,1,5-8H2,2-4H3 |
| InChIKey | CCZHHHZXNRGRRZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-4-(3,3,3-trifluoroprop-1-en-2-yloxy)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-(3,3,3-trifluoroprop-1-en-2-yloxy)cyclohexane?
The IUPAC name of 1-tert-butyl-4-(3,3,3-trifluoroprop-1-en-2-yloxy)cyclohexane (CID 135080583) is 1-tert-butyl-4-(3,3,3-trifluoroprop-1-en-2-yloxy)cyclohexane.
What is the SMILES notation for 1-tert-butyl-4-(3,3,3-trifluoroprop-1-en-2-yloxy)cyclohexane?
The canonical SMILES for 1-tert-butyl-4-(3,3,3-trifluoroprop-1-en-2-yloxy)cyclohexane is C=C(OC1CCC(C(C)(C)C)CC1)C(F)(F)F.
What is the InChIKey of 1-tert-butyl-4-(3,3,3-trifluoroprop-1-en-2-yloxy)cyclohexane?
The InChIKey is CCZHHHZXNRGRRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F3O/c1-9(13(14,15)16)17-11-7-5-10(6-8-11)12(2,3)4/h10-11H,1,5-8H2,2-4H3.
What are the key properties of 1-tert-butyl-4-(3,3,3-trifluoroprop-1-en-2-yloxy)cyclohexane?
1-tert-butyl-4-(3,3,3-trifluoroprop-1-en-2-yloxy)cyclohexane has a molecular weight of 250.30 g/mol, XLogP of 4.68, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-(3,3,3-trifluoroprop-1-en-2-yloxy)cyclohexane is sourced from PubChem (CID 135080583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).