About 4-heptyl-1,3-dimethyl-1,3-diazetidin-2-one
4-heptyl-1,3-dimethyl-1,3-diazetidin-2-one (PubChem CID 135080626) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is 4-heptyl-1,3-dimethyl-1,3-diazetidin-2-one.
Molecular Properties
| Compound Name | 4-heptyl-1,3-dimethyl-1,3-diazetidin-2-one |
| PubChem CID | 135080626 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 4-heptyl-1,3-dimethyl-1,3-diazetidin-2-one |
| SMILES | CCCCCCCC1N(C)C(=O)N1C |
| InChI | InChI=1S/C11H22N2O/c1-4-5-6-7-8-9-10-12(2)11(14)13(10)3/h10H,4-9H2,1-3H3 |
| InChIKey | GUYOJAKBDIPPHL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-heptyl-1,3-dimethyl-1,3-diazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-heptyl-1,3-dimethyl-1,3-diazetidin-2-one?
The IUPAC name of 4-heptyl-1,3-dimethyl-1,3-diazetidin-2-one (CID 135080626) is 4-heptyl-1,3-dimethyl-1,3-diazetidin-2-one.
What is the SMILES notation for 4-heptyl-1,3-dimethyl-1,3-diazetidin-2-one?
The canonical SMILES for 4-heptyl-1,3-dimethyl-1,3-diazetidin-2-one is CCCCCCCC1N(C)C(=O)N1C.
What is the InChIKey of 4-heptyl-1,3-dimethyl-1,3-diazetidin-2-one?
The InChIKey is GUYOJAKBDIPPHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O/c1-4-5-6-7-8-9-10-12(2)11(14)13(10)3/h10H,4-9H2,1-3H3.
What are the key properties of 4-heptyl-1,3-dimethyl-1,3-diazetidin-2-one?
4-heptyl-1,3-dimethyl-1,3-diazetidin-2-one has a molecular weight of 198.31 g/mol, XLogP of 2.67, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-heptyl-1,3-dimethyl-1,3-diazetidin-2-one is sourced from PubChem (CID 135080626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).