C11H14N2O3 — CID 135080668
N-[(3aS,7aS)-2-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]acetamide (PubChem CID 135080668) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is N-[(3aS,7aS)-2-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]acetamide.
| Compound Name | N-[(3aS,7aS)-2-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]acetamide |
|---|---|
| PubChem CID | 135080668 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | N-[(3aS,7aS)-2-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]acetamide |
| SMILES | CC(=O)NC1C=CC[C@@H]2C(=O)N(C)C(=O)[C@H]12 |
| InChI | InChI=1S/C11H14N2O3/c1-6(14)12-8-5-3-4-7-9(8)11(16)13(2)10(7)15/h3,5,7-9H,4H2,1-2H3,(H,12,14)/t7-,8?,9-/m0/s1 |
| InChIKey | WLAUQFJZSXSGIE-SMOXQLQSSA-N |
| XLogP | -0.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|