About 2-[[(E)-1,2-dichloroethenyl]-propan-2-yloxyphosphoryl]oxypropane
2-[[(E)-1,2-dichloroethenyl]-propan-2-yloxyphosphoryl]oxypropane (PubChem CID 135080812) has the molecular formula C8H15Cl2O3P
and a molecular weight of 261.08 g/mol. Its IUPAC name is 2-[[(E)-1,2-dichloroethenyl]-propan-2-yloxyphosphoryl]oxypropane.
Molecular Properties
| Compound Name | 2-[[(E)-1,2-dichloroethenyl]-propan-2-yloxyphosphoryl]oxypropane |
| PubChem CID | 135080812 |
| Molecular Formula | C8H15Cl2O3P |
| Molecular Weight | 261.08 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 2-[[(E)-1,2-dichloroethenyl]-propan-2-yloxyphosphoryl]oxypropane |
| SMILES | CC(C)OP(=O)(OC(C)C)/C(Cl)=C\Cl |
| InChI | InChI=1S/C8H15Cl2O3P/c1-6(2)12-14(11,8(10)5-9)13-7(3)4/h5-7H,1-4H3/b8-5- |
| InChIKey | OOHMQDFSCIYQDG-YVMONPNESA-N |
| XLogP | 4.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.08 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(E)-1,2-dichloroethenyl]-propan-2-yloxyphosphoryl]oxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(E)-1,2-dichloroethenyl]-propan-2-yloxyphosphoryl]oxypropane?
The IUPAC name of 2-[[(E)-1,2-dichloroethenyl]-propan-2-yloxyphosphoryl]oxypropane (CID 135080812) is 2-[[(E)-1,2-dichloroethenyl]-propan-2-yloxyphosphoryl]oxypropane.
What is the SMILES notation for 2-[[(E)-1,2-dichloroethenyl]-propan-2-yloxyphosphoryl]oxypropane?
The canonical SMILES for 2-[[(E)-1,2-dichloroethenyl]-propan-2-yloxyphosphoryl]oxypropane is CC(C)OP(=O)(OC(C)C)/C(Cl)=C\Cl.
What is the InChIKey of 2-[[(E)-1,2-dichloroethenyl]-propan-2-yloxyphosphoryl]oxypropane?
The InChIKey is OOHMQDFSCIYQDG-YVMONPNESA-N. The full InChI is InChI=1S/C8H15Cl2O3P/c1-6(2)12-14(11,8(10)5-9)13-7(3)4/h5-7H,1-4H3/b8-5-.
What are the key properties of 2-[[(E)-1,2-dichloroethenyl]-propan-2-yloxyphosphoryl]oxypropane?
2-[[(E)-1,2-dichloroethenyl]-propan-2-yloxyphosphoryl]oxypropane has a molecular weight of 261.08 g/mol, XLogP of 4.31, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(E)-1,2-dichloroethenyl]-propan-2-yloxyphosphoryl]oxypropane is sourced from PubChem (CID 135080812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).