About (1E)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene
(1E)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene (PubChem CID 135080968) has the molecular formula C8H14FO3P
and a molecular weight of 208.17 g/mol. Its IUPAC name is (1E)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene.
Molecular Properties
| Compound Name | (1E)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene |
| PubChem CID | 135080968 |
| Molecular Formula | C8H14FO3P |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (1E)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene |
| SMILES | C=C/C=C(\F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C8H14FO3P/c1-4-7-8(9)13(10,11-5-2)12-6-3/h4,7H,1,5-6H2,2-3H3/b8-7+ |
| InChIKey | QJPYZNMQFIGGGL-BQYQJAHWSA-N |
| XLogP | 3.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene?
The IUPAC name of (1E)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene (CID 135080968) is (1E)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene.
What is the SMILES notation for (1E)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene?
The canonical SMILES for (1E)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene is C=C/C=C(\F)P(=O)(OCC)OCC.
What is the InChIKey of (1E)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene?
The InChIKey is QJPYZNMQFIGGGL-BQYQJAHWSA-N. The full InChI is InChI=1S/C8H14FO3P/c1-4-7-8(9)13(10,11-5-2)12-6-3/h4,7H,1,5-6H2,2-3H3/b8-7+.
What are the key properties of (1E)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene?
(1E)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene has a molecular weight of 208.17 g/mol, XLogP of 3.25, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-diethoxyphosphoryl-1-fluorobuta-1,3-diene is sourced from PubChem (CID 135080968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).