About (2S)-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole
(2S)-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole (PubChem CID 135081127) has the molecular formula C11H12FN
and a molecular weight of 177.22 g/mol. Its IUPAC name is (2S)-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | (2S)-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole |
| PubChem CID | 135081127 |
| Molecular Formula | C11H12FN |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | (2S)-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole |
| SMILES | C[C@H]1CCC(c2ccc(F)cc2)=N1 |
| InChI | InChI=1S/C11H12FN/c1-8-2-7-11(13-8)9-3-5-10(12)6-4-9/h3-6,8H,2,7H2,1H3/t8-/m0/s1 |
| InChIKey | XHWLGVSCNFGESB-QMMMGPOBSA-N |
| XLogP | 2.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole?
The IUPAC name of (2S)-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole (CID 135081127) is (2S)-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for (2S)-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole?
The canonical SMILES for (2S)-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole is C[C@H]1CCC(c2ccc(F)cc2)=N1.
What is the InChIKey of (2S)-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole?
The InChIKey is XHWLGVSCNFGESB-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H12FN/c1-8-2-7-11(13-8)9-3-5-10(12)6-4-9/h3-6,8H,2,7H2,1H3/t8-/m0/s1.
What are the key properties of (2S)-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole?
(2S)-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole has a molecular weight of 177.22 g/mol, XLogP of 2.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-(4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 135081127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).