About ethyl 5-hydroxy-4,4-dimethyloxolane-2-carboxylate
ethyl 5-hydroxy-4,4-dimethyloxolane-2-carboxylate (PubChem CID 135081164) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is ethyl 5-hydroxy-4,4-dimethyloxolane-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-hydroxy-4,4-dimethyloxolane-2-carboxylate |
| PubChem CID | 135081164 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | ethyl 5-hydroxy-4,4-dimethyloxolane-2-carboxylate |
| SMILES | CCOC(=O)C1CC(C)(C)C(O)O1 |
| InChI | InChI=1S/C9H16O4/c1-4-12-7(10)6-5-9(2,3)8(11)13-6/h6,8,11H,4-5H2,1-3H3 |
| InChIKey | AZJPBBKTRZVQNF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-hydroxy-4,4-dimethyloxolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-hydroxy-4,4-dimethyloxolane-2-carboxylate?
The IUPAC name of ethyl 5-hydroxy-4,4-dimethyloxolane-2-carboxylate (CID 135081164) is ethyl 5-hydroxy-4,4-dimethyloxolane-2-carboxylate.
What is the SMILES notation for ethyl 5-hydroxy-4,4-dimethyloxolane-2-carboxylate?
The canonical SMILES for ethyl 5-hydroxy-4,4-dimethyloxolane-2-carboxylate is CCOC(=O)C1CC(C)(C)C(O)O1.
What is the InChIKey of ethyl 5-hydroxy-4,4-dimethyloxolane-2-carboxylate?
The InChIKey is AZJPBBKTRZVQNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c1-4-12-7(10)6-5-9(2,3)8(11)13-6/h6,8,11H,4-5H2,1-3H3.
What are the key properties of ethyl 5-hydroxy-4,4-dimethyloxolane-2-carboxylate?
ethyl 5-hydroxy-4,4-dimethyloxolane-2-carboxylate has a molecular weight of 188.22 g/mol, XLogP of 0.68, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-hydroxy-4,4-dimethyloxolane-2-carboxylate is sourced from PubChem (CID 135081164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).