About CID 135081329
CID 135081329 (PubChem CID 135081329) has the molecular formula C40H40Cl2Zr
and a molecular weight of 682.89 g/mol.
Molecular Properties
| Compound Name | CID 135081329 |
| PubChem CID | 135081329 |
| Molecular Formula | C40H40Cl2Zr |
| Molecular Weight | 682.89 g/mol |
| Exact Mass | 680.16 |
| IUPAC Name | — |
| SMILES | C[C]1[CH][CH][C](C([C]2[C]3[C](C=CC=C3C(C)(C)C)[C]3C=CC=C(C(C)(C)C)[C]32)(c2ccccc2)c2ccccc2)[CH]1.Cl[Zr]Cl |
| InChI | InChI=1S/C40H40.2ClH.Zr/c1-27-24-25-30(26-27)40(28-16-10-8-11-17-28,29-18-12-9-13-19-29)37-35-31(20-14-22-33(35)38(2,3)4)32-21-15-23-34(36(32)37)39(5,6)7;;;/h8-26H,1-7H3;2*1H;/q;;;+2/p-2 |
| InChIKey | FMOXWMQLHNYCRC-UHFFFAOYSA-L |
| XLogP | 11.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 682.89 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 135081329 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135081329?
The IUPAC name of CID 135081329 (CID 135081329) is not available.
What is the SMILES notation for CID 135081329?
The canonical SMILES for CID 135081329 is C[C]1[CH][CH][C](C([C]2[C]3[C](C=CC=C3C(C)(C)C)[C]3C=CC=C(C(C)(C)C)[C]32)(c2ccccc2)c2ccccc2)[CH]1.Cl[Zr]Cl.
What is the InChIKey of CID 135081329?
The InChIKey is FMOXWMQLHNYCRC-UHFFFAOYSA-L. The full InChI is InChI=1S/C40H40.2ClH.Zr/c1-27-24-25-30(26-27)40(28-16-10-8-11-17-28,29-18-12-9-13-19-29)37-35-31(20-14-22-33(35)38(2,3)4)32-21-15-23-34(36(32)37)39(5,6)7;;;/h8-26H,1-7H3;2*1H;/q;;;+2/p-2.
What are the key properties of CID 135081329?
CID 135081329 has a molecular weight of 682.89 g/mol, XLogP of 11.12, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135081329 is sourced from PubChem (CID 135081329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).