C19H26O5 — CID 135081394
(2E,4E,6R)-4-methyl-6-[(1R,3R,4S,5R)-1,3,4-trimethylspiro[2,9-dioxabicyclo[3.3.1]non-6-ene-8,2'-oxirane]-3-yl]hepta-2,4-dienoic acid (PubChem CID 135081394) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is (2E,4E,6R)-4-methyl-6-[(1R,3R,4S,5R)-1,3,4-trimethylspiro[2,9-dioxabicyclo[3.3.1]non-6-ene-8,2'-oxirane]-3-yl]hepta-2,4-dienoic acid.
| Compound Name | (2E,4E,6R)-4-methyl-6-[(1R,3R,4S,5R)-1,3,4-trimethylspiro[2,9-dioxabicyclo[3.3.1]non-6-ene-8,2'-oxirane]-3-yl]hepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 135081394 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (2E,4E,6R)-4-methyl-6-[(1R,3R,4S,5R)-1,3,4-trimethylspiro[2,9-dioxabicyclo[3.3.1]non-6-ene-8,2'-oxirane]-3-yl]hepta-2,4-dienoic acid |
| SMILES | CC(/C=C/C(=O)O)=C\[C@@H](C)[C@@]1(C)O[C@@]2(C)O[C@H](C=CC23CO3)[C@@H]1C |
| InChI | InChI=1S/C19H26O5/c1-12(6-7-16(20)21)10-13(2)17(4)14(3)15-8-9-19(11-22-19)18(5,23-15)24-17/h6-10,13-15H,11H2,1-5H3,(H,20,21)/b7-6+,12-10+/t13-,14+,15-,17-,18-,19?/m1/s1 |
| InChIKey | WVSLUJGJEORBCE-UPVADNKTSA-N |
| XLogP | 3.07 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|