About CID 135081458
CID 135081458 (PubChem CID 135081458) has the molecular formula C29H34Cl2Zr
and a molecular weight of 544.72 g/mol.
Molecular Properties
| Compound Name | CID 135081458 |
| PubChem CID | 135081458 |
| Molecular Formula | C29H34Cl2Zr |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | — |
| SMILES | CC(C)([C]1[CH][CH][CH][CH]1)[C]1[C]2[C](C=CC=C2C(C)(C)C)[C]2C=CC=C(C(C)(C)C)[C]21.Cl[Zr]Cl |
| InChI | InChI=1S/C29H34.2ClH.Zr/c1-27(2,3)22-17-11-15-20-21-16-12-18-23(28(4,5)6)25(21)26(24(20)22)29(7,8)19-13-9-10-14-19;;;/h9-18H,1-8H3;2*1H;/q;;;+2/p-2 |
| InChIKey | OVVSOVQSGXZZAX-UHFFFAOYSA-L |
| XLogP | 8.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 135081458 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135081458?
The IUPAC name of CID 135081458 (CID 135081458) is not available.
What is the SMILES notation for CID 135081458?
The canonical SMILES for CID 135081458 is CC(C)([C]1[CH][CH][CH][CH]1)[C]1[C]2[C](C=CC=C2C(C)(C)C)[C]2C=CC=C(C(C)(C)C)[C]21.Cl[Zr]Cl.
What is the InChIKey of CID 135081458?
The InChIKey is OVVSOVQSGXZZAX-UHFFFAOYSA-L. The full InChI is InChI=1S/C29H34.2ClH.Zr/c1-27(2,3)22-17-11-15-20-21-16-12-18-23(28(4,5)6)25(21)26(24(20)22)29(7,8)19-13-9-10-14-19;;;/h9-18H,1-8H3;2*1H;/q;;;+2/p-2.
What are the key properties of CID 135081458?
CID 135081458 has a molecular weight of 544.72 g/mol, XLogP of 8.77, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135081458 is sourced from PubChem (CID 135081458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).