About CID 135081470
CID 135081470 (PubChem CID 135081470) has the molecular formula C32H24Cl2Zr
and a molecular weight of 570.67 g/mol.
Molecular Properties
| Compound Name | CID 135081470 |
| PubChem CID | 135081470 |
| Molecular Formula | C32H24Cl2Zr |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 568.03 |
| IUPAC Name | — |
| SMILES | C[C]1[CH][CH][C](C([C]2[C]3C=CC=C[C]3[C]3C=CC=C[C]32)(c2ccccc2)c2ccccc2)[CH]1.Cl[Zr]Cl |
| InChI | InChI=1S/C32H24.2ClH.Zr/c1-23-20-21-26(22-23)32(24-12-4-2-5-13-24,25-14-6-3-7-15-25)31-29-18-10-8-16-27(29)28-17-9-11-19-30(28)31;;;/h2-22H,1H3;2*1H;/q;;;+2/p-2 |
| InChIKey | DMNJITWKCSAFEW-UHFFFAOYSA-L |
| XLogP | 8.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 135081470 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135081470?
The IUPAC name of CID 135081470 (CID 135081470) is not available.
What is the SMILES notation for CID 135081470?
The canonical SMILES for CID 135081470 is C[C]1[CH][CH][C](C([C]2[C]3C=CC=C[C]3[C]3C=CC=C[C]32)(c2ccccc2)c2ccccc2)[CH]1.Cl[Zr]Cl.
What is the InChIKey of CID 135081470?
The InChIKey is DMNJITWKCSAFEW-UHFFFAOYSA-L. The full InChI is InChI=1S/C32H24.2ClH.Zr/c1-23-20-21-26(22-23)32(24-12-4-2-5-13-24,25-14-6-3-7-15-25)31-29-18-10-8-16-27(29)28-17-9-11-19-30(28)31;;;/h2-22H,1H3;2*1H;/q;;;+2/p-2.
What are the key properties of CID 135081470?
CID 135081470 has a molecular weight of 570.67 g/mol, XLogP of 8.28, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135081470 is sourced from PubChem (CID 135081470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).