C13H14N2O — CID 135081533
(1R,2S,6R,7S)-9-diazo-10,11-dimethyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one (PubChem CID 135081533) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is (1R,2S,6R,7S)-9-diazo-10,11-dimethyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one.
| Compound Name | (1R,2S,6R,7S)-9-diazo-10,11-dimethyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
|---|---|
| PubChem CID | 135081533 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | (1R,2S,6R,7S)-9-diazo-10,11-dimethyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
| SMILES | CC1=C(C)[C@@H]2C(=[N+]=[N-])C(=O)[C@H]1[C@@H]1C=CC[C@H]21 |
| InChI | InChI=1S/C13H14N2O/c1-6-7(2)11-9-5-3-4-8(9)10(6)12(15-14)13(11)16/h3,5,8-11H,4H2,1-2H3/t8-,9+,10-,11+/m0/s1 |
| InChIKey | IUNRZBOMFYZKGK-ZRUFSTJUSA-N |
| XLogP | 2.01 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|