C36H50N3+ — CID 135082147
3-[(Z)-10-pyridin-4-yldec-7-enyl]-1-[(Z)-11-pyridin-3-ylundec-9-enyl]pyridin-1-ium (PubChem CID 135082147) has the molecular formula C36H50N3+ and a molecular weight of 524.82 g/mol. Its IUPAC name is 3-[(Z)-10-pyridin-4-yldec-7-enyl]-1-[(Z)-11-pyridin-3-ylundec-9-enyl]pyridin-1-ium.
| Compound Name | 3-[(Z)-10-pyridin-4-yldec-7-enyl]-1-[(Z)-11-pyridin-3-ylundec-9-enyl]pyridin-1-ium |
|---|---|
| PubChem CID | 135082147 |
| Molecular Formula | C36H50N3+ |
| Molecular Weight | 524.82 g/mol |
| Exact Mass | 524.40 |
| IUPAC Name | 3-[(Z)-10-pyridin-4-yldec-7-enyl]-1-[(Z)-11-pyridin-3-ylundec-9-enyl]pyridin-1-ium |
| SMILES | C(=C\Cc1cccnc1)\CCCCCCCC[n+]1cccc(CCCCCC/C=C\CCc2ccncc2)c1 |
| InChI | InChI=1S/C36H50N3/c1(2-7-11-15-21-35-23-18-27-38-32-35)5-9-13-17-30-39-31-19-24-36(33-39)22-16-12-8-4-3-6-10-14-20-34-25-28-37-29-26-34/h6,10-11,15,18-19,23-29,31-33H,1-5,7-9,12-14,16-17,20-22,30H2/q+1/b10-6-,15-11- |
| InChIKey | ZBCBPUJKMYIGBL-IPBHLIGWSA-N |
| XLogP | 8.98 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.82 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|