C11H12O4 — CID 135082397
(6R)-6-ethynyl-6-hydroxy-4,4a,5,7,8,8a-hexahydroisochromene-1,3-dione (PubChem CID 135082397) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is (6R)-6-ethynyl-6-hydroxy-4,4a,5,7,8,8a-hexahydroisochromene-1,3-dione.
| Compound Name | (6R)-6-ethynyl-6-hydroxy-4,4a,5,7,8,8a-hexahydroisochromene-1,3-dione |
|---|---|
| PubChem CID | 135082397 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (6R)-6-ethynyl-6-hydroxy-4,4a,5,7,8,8a-hexahydroisochromene-1,3-dione |
| SMILES | C#C[C@@]1(O)CCC2C(=O)OC(=O)CC2C1 |
| InChI | InChI=1S/C11H12O4/c1-2-11(14)4-3-8-7(6-11)5-9(12)15-10(8)13/h1,7-8,14H,3-6H2/t7?,8?,11-/m1/s1 |
| InChIKey | FRYJQTIJNMMUDN-OIAXGBPSSA-N |
| XLogP | 0.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|