About lithium 2-(4-chlorobenzene-6-id-1-yl)-2-methyl-1,3-dioxolane
lithium 2-(4-chlorobenzene-6-id-1-yl)-2-methyl-1,3-dioxolane (PubChem CID 135082478) has the molecular formula C10H10ClLiO2
and a molecular weight of 204.58 g/mol. Its IUPAC name is lithium 2-(4-chlorobenzene-6-id-1-yl)-2-methyl-1,3-dioxolane.
Molecular Properties
| Compound Name | lithium 2-(4-chlorobenzene-6-id-1-yl)-2-methyl-1,3-dioxolane |
| PubChem CID | 135082478 |
| Molecular Formula | C10H10ClLiO2 |
| Molecular Weight | 204.58 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | lithium 2-(4-chlorobenzene-6-id-1-yl)-2-methyl-1,3-dioxolane |
| SMILES | CC1(c2[c-]cc(Cl)cc2)OCCO1.[Li+] |
| InChI | InChI=1S/C10H10ClO2.Li/c1-10(12-6-7-13-10)8-2-4-9(11)5-3-8;/h2,4-5H,6-7H2,1H3;/q-1;+1 |
| InChIKey | JNFOXRDKZOOCII-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.58 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium 2-(4-chlorobenzene-6-id-1-yl)-2-methyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-(4-chlorobenzene-6-id-1-yl)-2-methyl-1,3-dioxolane?
The IUPAC name of lithium 2-(4-chlorobenzene-6-id-1-yl)-2-methyl-1,3-dioxolane (CID 135082478) is lithium 2-(4-chlorobenzene-6-id-1-yl)-2-methyl-1,3-dioxolane.
What is the SMILES notation for lithium 2-(4-chlorobenzene-6-id-1-yl)-2-methyl-1,3-dioxolane?
The canonical SMILES for lithium 2-(4-chlorobenzene-6-id-1-yl)-2-methyl-1,3-dioxolane is CC1(c2[c-]cc(Cl)cc2)OCCO1.[Li+].
What is the InChIKey of lithium 2-(4-chlorobenzene-6-id-1-yl)-2-methyl-1,3-dioxolane?
The InChIKey is JNFOXRDKZOOCII-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClO2.Li/c1-10(12-6-7-13-10)8-2-4-9(11)5-3-8;/h2,4-5H,6-7H2,1H3;/q-1;+1.
What are the key properties of lithium 2-(4-chlorobenzene-6-id-1-yl)-2-methyl-1,3-dioxolane?
lithium 2-(4-chlorobenzene-6-id-1-yl)-2-methyl-1,3-dioxolane has a molecular weight of 204.58 g/mol, XLogP of -0.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-(4-chlorobenzene-6-id-1-yl)-2-methyl-1,3-dioxolane is sourced from PubChem (CID 135082478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).