About dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium;hydrogen sulfate
dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium;hydrogen sulfate (PubChem CID 135082776) has the molecular formula C11H13NO5S2
and a molecular weight of 303.36 g/mol. Its IUPAC name is dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium;hydrogen sulfate.
Molecular Properties
| Compound Name | dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium;hydrogen sulfate |
| PubChem CID | 135082776 |
| Molecular Formula | C11H13NO5S2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium;hydrogen sulfate |
| SMILES | C[N+](C)=c1oc(-c2ccccc2)cs1.O=S(=O)([O-])O |
| InChI | InChI=1S/C11H12NOS.H2O4S/c1-12(2)11-13-10(8-14-11)9-6-4-3-5-7-9;1-5(2,3)4/h3-8H,1-2H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | IEXXJSDDTDECCS-UHFFFAOYSA-M |
| XLogP | 1.04 |
| TPSA | 93.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium;hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium;hydrogen sulfate?
The IUPAC name of dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium;hydrogen sulfate (CID 135082776) is dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium;hydrogen sulfate.
What is the SMILES notation for dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium;hydrogen sulfate?
The canonical SMILES for dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium;hydrogen sulfate is C[N+](C)=c1oc(-c2ccccc2)cs1.O=S(=O)([O-])O.
What is the InChIKey of dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium;hydrogen sulfate?
The InChIKey is IEXXJSDDTDECCS-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H12NOS.H2O4S/c1-12(2)11-13-10(8-14-11)9-6-4-3-5-7-9;1-5(2,3)4/h3-8H,1-2H3;(H2,1,2,3,4)/q+1;/p-1.
What are the key properties of dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium;hydrogen sulfate?
dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium;hydrogen sulfate has a molecular weight of 303.36 g/mol, XLogP of 1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-(5-phenyl-1,3-oxathiol-2-ylidene)azanium;hydrogen sulfate is sourced from PubChem (CID 135082776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).