C8H9NO2 — CID 135082926
7,8-dihydro-3H-pyrido[1,2-c][1,3]oxazin-1-one (PubChem CID 135082926) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 7,8-dihydro-3H-pyrido[1,2-c][1,3]oxazin-1-one.
| Compound Name | 7,8-dihydro-3H-pyrido[1,2-c][1,3]oxazin-1-one |
|---|---|
| PubChem CID | 135082926 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 7,8-dihydro-3H-pyrido[1,2-c][1,3]oxazin-1-one |
| SMILES | O=C1OCC=C2C=CCCN12 |
| InChI | InChI=1S/C8H9NO2/c10-8-9-5-2-1-3-7(9)4-6-11-8/h1,3-4H,2,5-6H2 |
| InChIKey | XWXIQNPXINRZMF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |