About 2,3-benzodiselenine
2,3-benzodiselenine (PubChem CID 135082929) has the molecular formula C8H6Se2
and a molecular weight of 260.06 g/mol. Its IUPAC name is 2,3-benzodiselenine.
Molecular Properties
| Compound Name | 2,3-benzodiselenine |
| PubChem CID | 135082929 |
| Molecular Formula | C8H6Se2 |
| Molecular Weight | 260.06 g/mol |
| Exact Mass | 261.88 |
| IUPAC Name | 2,3-benzodiselenine |
| SMILES | C1=c2ccccc2=C[Se][Se]1 |
| InChI | InChI=1S/C8H6Se2/c1-2-4-8-6-10-9-5-7(8)3-1/h1-6H |
| InChIKey | ZWFRBRCOURUYSS-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.06 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,3-benzodiselenine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-benzodiselenine?
The IUPAC name of 2,3-benzodiselenine (CID 135082929) is 2,3-benzodiselenine.
What is the SMILES notation for 2,3-benzodiselenine?
The canonical SMILES for 2,3-benzodiselenine is C1=c2ccccc2=C[Se][Se]1.
What is the InChIKey of 2,3-benzodiselenine?
The InChIKey is ZWFRBRCOURUYSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Se2/c1-2-4-8-6-10-9-5-7(8)3-1/h1-6H.
What are the key properties of 2,3-benzodiselenine?
2,3-benzodiselenine has a molecular weight of 260.06 g/mol, XLogP of -0.50, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-benzodiselenine is sourced from PubChem (CID 135082929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).