C20H32O2 — CID 135082973
(1S,2S,4S,6E,10E,14R)-1,7,11-trimethyl-4-prop-1-en-2-yl-15-oxabicyclo[12.1.0]pentadeca-6,10-dien-2-ol (PubChem CID 135082973) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,2S,4S,6E,10E,14R)-1,7,11-trimethyl-4-prop-1-en-2-yl-15-oxabicyclo[12.1.0]pentadeca-6,10-dien-2-ol.
| Compound Name | (1S,2S,4S,6E,10E,14R)-1,7,11-trimethyl-4-prop-1-en-2-yl-15-oxabicyclo[12.1.0]pentadeca-6,10-dien-2-ol |
|---|---|
| PubChem CID | 135082973 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,2S,4S,6E,10E,14R)-1,7,11-trimethyl-4-prop-1-en-2-yl-15-oxabicyclo[12.1.0]pentadeca-6,10-dien-2-ol |
| SMILES | C=C(C)[C@H]1C/C=C(\C)CC/C=C(\C)CC[C@H]2O[C@@]2(C)[C@@H](O)C1 |
| InChI | InChI=1S/C20H32O2/c1-14(2)17-11-9-15(3)7-6-8-16(4)10-12-19-20(5,22-19)18(21)13-17/h8-9,17-19,21H,1,6-7,10-13H2,2-5H3/b15-9+,16-8+/t17-,18-,19+,20-/m0/s1 |
| InChIKey | WRTAVCMHCGQYIV-HFICDBJMSA-N |
| XLogP | 4.94 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|