C15H6F10O3S2 — CID 135083139
[3,7-difluoro-5-(1,1,2,2,2-pentafluoroethyl)dibenzothiophen-5-yl] trifluoromethanesulfonate (PubChem CID 135083139) has the molecular formula C15H6F10O3S2 and a molecular weight of 488.32 g/mol. Its IUPAC name is [3,7-difluoro-5-(1,1,2,2,2-pentafluoroethyl)dibenzothiophen-5-yl] trifluoromethanesulfonate.
| Compound Name | [3,7-difluoro-5-(1,1,2,2,2-pentafluoroethyl)dibenzothiophen-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135083139 |
| Molecular Formula | C15H6F10O3S2 |
| Molecular Weight | 488.32 g/mol |
| Exact Mass | 487.96 |
| IUPAC Name | [3,7-difluoro-5-(1,1,2,2,2-pentafluoroethyl)dibenzothiophen-5-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OS1(C(F)(F)C(F)(F)F)c2cc(F)ccc2-c2ccc(F)cc21)C(F)(F)F |
| InChI | InChI=1S/C15H6F10O3S2/c16-7-1-3-9-10-4-2-8(17)6-12(10)29(11(9)5-7,14(21,22)13(18,19)20)28-30(26,27)15(23,24)25/h1-6H |
| InChIKey | GBVBNSPWFCDSCZ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.32 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|