C25H24F12O3S2 — CID 135083141
[3,7-ditert-butyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)dibenzothiophen-5-yl] trifluoromethanesulfonate (PubChem CID 135083141) has the molecular formula C25H24F12O3S2 and a molecular weight of 664.57 g/mol. Its IUPAC name is [3,7-ditert-butyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)dibenzothiophen-5-yl] trifluoromethanesulfonate.
| Compound Name | [3,7-ditert-butyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)dibenzothiophen-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135083141 |
| Molecular Formula | C25H24F12O3S2 |
| Molecular Weight | 664.57 g/mol |
| Exact Mass | 664.10 |
| IUPAC Name | [3,7-ditert-butyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)dibenzothiophen-5-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1ccc2c(c1)S(OS(=O)(=O)C(F)(F)F)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C25H24F12O3S2/c1-19(2,3)13-7-9-15-16-10-8-14(20(4,5)6)12-18(16)41(17(15)11-13,40-42(38,39)25(35,36)37)24(33,34)22(28,29)21(26,27)23(30,31)32/h7-12H,1-6H3 |
| InChIKey | UJALXWOXJRKVOZ-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.57 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|