About 7-(diethylamino)-2,5-dimethylazepin-4-one
7-(diethylamino)-2,5-dimethylazepin-4-one (PubChem CID 135083250) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is 7-(diethylamino)-2,5-dimethylazepin-4-one.
Molecular Properties
| Compound Name | 7-(diethylamino)-2,5-dimethylazepin-4-one |
| PubChem CID | 135083250 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 7-(diethylamino)-2,5-dimethylazepin-4-one |
| SMILES | CCN(CC)c1cc(C)c(=O)cc(C)n1 |
| InChI | InChI=1S/C12H18N2O/c1-5-14(6-2)12-7-9(3)11(15)8-10(4)13-12/h7-8H,5-6H2,1-4H3 |
| InChIKey | HBVIANOKOFXOSX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(diethylamino)-2,5-dimethylazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(diethylamino)-2,5-dimethylazepin-4-one?
The IUPAC name of 7-(diethylamino)-2,5-dimethylazepin-4-one (CID 135083250) is 7-(diethylamino)-2,5-dimethylazepin-4-one.
What is the SMILES notation for 7-(diethylamino)-2,5-dimethylazepin-4-one?
The canonical SMILES for 7-(diethylamino)-2,5-dimethylazepin-4-one is CCN(CC)c1cc(C)c(=O)cc(C)n1.
What is the InChIKey of 7-(diethylamino)-2,5-dimethylazepin-4-one?
The InChIKey is HBVIANOKOFXOSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O/c1-5-14(6-2)12-7-9(3)11(15)8-10(4)13-12/h7-8H,5-6H2,1-4H3.
What are the key properties of 7-(diethylamino)-2,5-dimethylazepin-4-one?
7-(diethylamino)-2,5-dimethylazepin-4-one has a molecular weight of 206.29 g/mol, XLogP of 1.90, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(diethylamino)-2,5-dimethylazepin-4-one is sourced from PubChem (CID 135083250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).