About N'-(benzenesulfonyl)-2,2,2-trifluoro-N-(trichloro-λ5-phosphanylidene)ethanimidamide
N'-(benzenesulfonyl)-2,2,2-trifluoro-N-(trichloro-λ5-phosphanylidene)ethanimidamide (PubChem CID 135083255) has the molecular formula C8H5Cl3F3N2O2PS
and a molecular weight of 387.53 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-2,2,2-trifluoro-N-(trichloro-λ5-phosphanylidene)ethanimidamide.
Molecular Properties
| Compound Name | N'-(benzenesulfonyl)-2,2,2-trifluoro-N-(trichloro-λ5-phosphanylidene)ethanimidamide |
| PubChem CID | 135083255 |
| Molecular Formula | C8H5Cl3F3N2O2PS |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 385.88 |
| IUPAC Name | N'-(benzenesulfonyl)-2,2,2-trifluoro-N-(trichloro-λ5-phosphanylidene)ethanimidamide |
| SMILES | O=S(=O)(/N=C(\N=P(Cl)(Cl)Cl)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C8H5Cl3F3N2O2PS/c9-19(10,11)15-7(8(12,13)14)16-20(17,18)6-4-2-1-3-5-6/h1-5H/b16-7- |
| InChIKey | ZYQJOWUPTIDMOE-APSNUPSMSA-N |
| XLogP | 5.00 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N'-(benzenesulfonyl)-2,2,2-trifluoro-N-(trichloro-λ5-phosphanylidene)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(benzenesulfonyl)-2,2,2-trifluoro-N-(trichloro-λ5-phosphanylidene)ethanimidamide?
The IUPAC name of N'-(benzenesulfonyl)-2,2,2-trifluoro-N-(trichloro-λ5-phosphanylidene)ethanimidamide (CID 135083255) is N'-(benzenesulfonyl)-2,2,2-trifluoro-N-(trichloro-λ5-phosphanylidene)ethanimidamide.
What is the SMILES notation for N'-(benzenesulfonyl)-2,2,2-trifluoro-N-(trichloro-λ5-phosphanylidene)ethanimidamide?
The canonical SMILES for N'-(benzenesulfonyl)-2,2,2-trifluoro-N-(trichloro-λ5-phosphanylidene)ethanimidamide is O=S(=O)(/N=C(\N=P(Cl)(Cl)Cl)C(F)(F)F)c1ccccc1.
What is the InChIKey of N'-(benzenesulfonyl)-2,2,2-trifluoro-N-(trichloro-λ5-phosphanylidene)ethanimidamide?
The InChIKey is ZYQJOWUPTIDMOE-APSNUPSMSA-N. The full InChI is InChI=1S/C8H5Cl3F3N2O2PS/c9-19(10,11)15-7(8(12,13)14)16-20(17,18)6-4-2-1-3-5-6/h1-5H/b16-7-.
What are the key properties of N'-(benzenesulfonyl)-2,2,2-trifluoro-N-(trichloro-λ5-phosphanylidene)ethanimidamide?
N'-(benzenesulfonyl)-2,2,2-trifluoro-N-(trichloro-λ5-phosphanylidene)ethanimidamide has a molecular weight of 387.53 g/mol, XLogP of 5.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(benzenesulfonyl)-2,2,2-trifluoro-N-(trichloro-λ5-phosphanylidene)ethanimidamide is sourced from PubChem (CID 135083255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).