C40H68O2P2 — CID 135083391
(15S,16S)-15,16-bis(dicyclohexylphosphoryl)tetracyclo[6.6.2.02,7.09,14]hexadecane (PubChem CID 135083391) has the molecular formula C40H68O2P2 and a molecular weight of 642.93 g/mol. Its IUPAC name is (15S,16S)-15,16-bis(dicyclohexylphosphoryl)tetracyclo[6.6.2.02,7.09,14]hexadecane.
| Compound Name | (15S,16S)-15,16-bis(dicyclohexylphosphoryl)tetracyclo[6.6.2.02,7.09,14]hexadecane |
|---|---|
| PubChem CID | 135083391 |
| Molecular Formula | C40H68O2P2 |
| Molecular Weight | 642.93 g/mol |
| Exact Mass | 642.47 |
| IUPAC Name | (15S,16S)-15,16-bis(dicyclohexylphosphoryl)tetracyclo[6.6.2.02,7.09,14]hexadecane |
| SMILES | O=P(C1CCCCC1)(C1CCCCC1)[C@H]1C2C3CCCCC3C(C3CCCCC32)[C@@H]1P(=O)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C40H68O2P2/c41-43(29-17-5-1-6-18-29,30-19-7-2-8-20-30)39-37-33-25-13-15-27-35(33)38(36-28-16-14-26-34(36)37)40(39)44(42,31-21-9-3-10-22-31)32-23-11-4-12-24-32/h29-40H,1-28H2/t33?,34?,35?,36?,37?,38?,39-,40-/m0/s1 |
| InChIKey | LQWDFYHOWSEZCH-FSOCDGORSA-N |
| XLogP | 12.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.93 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|