C25H40O4S2 — CID 135083461
(5S)-5-[(3S,4R)-5-(1,3-dithian-2-yl)-4-[(4-methoxyphenyl)methoxy]-3-methylpentyl]-2,2,4,4-tetramethyl-1,3-dioxolane (PubChem CID 135083461) has the molecular formula C25H40O4S2 and a molecular weight of 468.73 g/mol. Its IUPAC name is (5S)-5-[(3S,4R)-5-(1,3-dithian-2-yl)-4-[(4-methoxyphenyl)methoxy]-3-methylpentyl]-2,2,4,4-tetramethyl-1,3-dioxolane.
| Compound Name | (5S)-5-[(3S,4R)-5-(1,3-dithian-2-yl)-4-[(4-methoxyphenyl)methoxy]-3-methylpentyl]-2,2,4,4-tetramethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 135083461 |
| Molecular Formula | C25H40O4S2 |
| Molecular Weight | 468.73 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | (5S)-5-[(3S,4R)-5-(1,3-dithian-2-yl)-4-[(4-methoxyphenyl)methoxy]-3-methylpentyl]-2,2,4,4-tetramethyl-1,3-dioxolane |
| SMILES | COc1ccc(CO[C@H](CC2SCCCS2)[C@@H](C)CC[C@@H]2OC(C)(C)OC2(C)C)cc1 |
| InChI | InChI=1S/C25H40O4S2/c1-18(8-13-22-24(2,3)29-25(4,5)28-22)21(16-23-30-14-7-15-31-23)27-17-19-9-11-20(26-6)12-10-19/h9-12,18,21-23H,7-8,13-17H2,1-6H3/t18-,21+,22-/m0/s1 |
| InChIKey | ZAMGNOOCUDBHSQ-BWAGFHJFSA-N |
| XLogP | 6.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.73 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |