About bis(trimethylsilyl)methyl-chloro-trimethyl-λ5-phosphane;gold(1+);trimethylphosphane
bis(trimethylsilyl)methyl-chloro-trimethyl-λ5-phosphane;gold(1+);trimethylphosphane (PubChem CID 135083490) has the molecular formula C13H36AuClP2Si2
and a molecular weight of 542.97 g/mol. Its IUPAC name is bis(trimethylsilyl)methyl-chloro-trimethyl-λ5-phosphane;gold(1+);trimethylphosphane.
Molecular Properties
| Compound Name | bis(trimethylsilyl)methyl-chloro-trimethyl-λ5-phosphane;gold(1+);trimethylphosphane |
|---|
| PubChem CID | 135083490 |
|---|
| Molecular Formula | C13H36AuClP2Si2 |
|---|
| Molecular Weight | 542.97 g/mol |
|---|
| Exact Mass | 542.12 |
|---|
| IUPAC Name | bis(trimethylsilyl)methyl-chloro-trimethyl-λ5-phosphane;gold(1+);trimethylphosphane |
|---|
| SMILES | CP(C)C.C[Si](C)(C)[C-]([Si](C)(C)C)P(C)(C)(C)Cl.[Au+] |
|---|
| InChI | InChI=1S/C10H27ClPSi2.C3H9P.Au/c1-12(2,3,11)10(13(4,5)6)14(7,8)9;1-4(2)3;/h1-9H3;1-3H3;/q-1;;+1 |
|---|
| InChIKey | FAIIUFFAGDNNQS-UHFFFAOYSA-N |
|---|
| XLogP | 6.22 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | 3 |
|---|
| Heavy Atoms | 19 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
2 violations
| Rule | Value |
|---|
| MW ≤ 500 | 542.97 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(trimethylsilyl)methyl-chloro-trimethyl-λ5-phosphane;gold(1+);trimethylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trimethylsilyl)methyl-chloro-trimethyl-λ5-phosphane;gold(1+);trimethylphosphane?
The IUPAC name of bis(trimethylsilyl)methyl-chloro-trimethyl-λ5-phosphane;gold(1+);trimethylphosphane (CID 135083490) is bis(trimethylsilyl)methyl-chloro-trimethyl-λ5-phosphane;gold(1+);trimethylphosphane.
What is the SMILES notation for bis(trimethylsilyl)methyl-chloro-trimethyl-λ5-phosphane;gold(1+);trimethylphosphane?
The canonical SMILES for bis(trimethylsilyl)methyl-chloro-trimethyl-λ5-phosphane;gold(1+);trimethylphosphane is CP(C)C.C[Si](C)(C)[C-]([Si](C)(C)C)P(C)(C)(C)Cl.[Au+].
What is the InChIKey of bis(trimethylsilyl)methyl-chloro-trimethyl-λ5-phosphane;gold(1+);trimethylphosphane?
The InChIKey is FAIIUFFAGDNNQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H27ClPSi2.C3H9P.Au/c1-12(2,3,11)10(13(4,5)6)14(7,8)9;1-4(2)3;/h1-9H3;1-3H3;/q-1;;+1.
What are the key properties of bis(trimethylsilyl)methyl-chloro-trimethyl-λ5-phosphane;gold(1+);trimethylphosphane?
bis(trimethylsilyl)methyl-chloro-trimethyl-λ5-phosphane;gold(1+);trimethylphosphane has a molecular weight of 542.97 g/mol, XLogP of 6.22, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trimethylsilyl)methyl-chloro-trimethyl-λ5-phosphane;gold(1+);trimethylphosphane is sourced from PubChem (CID 135083490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).