About carbanide;gold(3+);methanidyl(dimethyl)sulfanium
carbanide;gold(3+);methanidyl(dimethyl)sulfanium (PubChem CID 135083493) has the molecular formula C6H17AuS
and a molecular weight of 318.24 g/mol. Its IUPAC name is carbanide;gold(3+);methanidyl(dimethyl)sulfanium.
Molecular Properties
| Compound Name | carbanide;gold(3+);methanidyl(dimethyl)sulfanium |
| PubChem CID | 135083493 |
| Molecular Formula | C6H17AuS |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | carbanide;gold(3+);methanidyl(dimethyl)sulfanium |
| SMILES | [Au+3].[CH2-][S+](C)C.[CH3-].[CH3-].[CH3-] |
| InChI | InChI=1S/C3H8S.3CH3.Au/c1-4(2)3;;;;/h1H2,2-3H3;3*1H3;/q;3*-1;+3 |
| InChIKey | GAKHXNLDCCAIQJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze carbanide;gold(3+);methanidyl(dimethyl)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;gold(3+);methanidyl(dimethyl)sulfanium?
The IUPAC name of carbanide;gold(3+);methanidyl(dimethyl)sulfanium (CID 135083493) is carbanide;gold(3+);methanidyl(dimethyl)sulfanium.
What is the SMILES notation for carbanide;gold(3+);methanidyl(dimethyl)sulfanium?
The canonical SMILES for carbanide;gold(3+);methanidyl(dimethyl)sulfanium is [Au+3].[CH2-][S+](C)C.[CH3-].[CH3-].[CH3-].
What is the InChIKey of carbanide;gold(3+);methanidyl(dimethyl)sulfanium?
The InChIKey is GAKHXNLDCCAIQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8S.3CH3.Au/c1-4(2)3;;;;/h1H2,2-3H3;3*1H3;/q;3*-1;+3.
What are the key properties of carbanide;gold(3+);methanidyl(dimethyl)sulfanium?
carbanide;gold(3+);methanidyl(dimethyl)sulfanium has a molecular weight of 318.24 g/mol, XLogP of 2.00, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;gold(3+);methanidyl(dimethyl)sulfanium is sourced from PubChem (CID 135083493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).