C9H12Li2O4 — CID 135083615
dilithium;(3aS,4R,5R,7aR)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole-4,5-diolate (PubChem CID 135083615) has the molecular formula C9H12Li2O4 and a molecular weight of 198.07 g/mol. Its IUPAC name is dilithium;(3aS,4R,5R,7aR)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole-4,5-diolate.
| Compound Name | dilithium;(3aS,4R,5R,7aR)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole-4,5-diolate |
|---|---|
| PubChem CID | 135083615 |
| Molecular Formula | C9H12Li2O4 |
| Molecular Weight | 198.07 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | dilithium;(3aS,4R,5R,7aR)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole-4,5-diolate |
| SMILES | CC1(C)O[C@H]2[C@H]([O-])[C@H]([O-])C=C[C@H]2O1.[Li+].[Li+] |
| InChI | InChI=1S/C9H12O4.2Li/c1-9(2)12-6-4-3-5(10)7(11)8(6)13-9;;/h3-8H,1-2H3;;/q-2;2*+1/t5-,6-,7-,8-;;/m1../s1 |
| InChIKey | ARMOINQOWNEVIX-SWVWMVOQSA-N |
| XLogP | -7.46 |
| TPSA | 64.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.07 |
| LogP ≤ 5 | -7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|