About (E)-3-(carbamoyldiazenyl)-N,N-diethylbut-2-enamide
(E)-3-(carbamoyldiazenyl)-N,N-diethylbut-2-enamide (PubChem CID 135083693) has the molecular formula C9H16N4O2
and a molecular weight of 212.25 g/mol. Its IUPAC name is (E)-3-(carbamoyldiazenyl)-N,N-diethylbut-2-enamide.
Molecular Properties
| Compound Name | (E)-3-(carbamoyldiazenyl)-N,N-diethylbut-2-enamide |
| PubChem CID | 135083693 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (E)-3-(carbamoyldiazenyl)-N,N-diethylbut-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C(C)/N=N/C(N)=O |
| InChI | InChI=1S/C9H16N4O2/c1-4-13(5-2)8(14)6-7(3)11-12-9(10)15/h6H,4-5H2,1-3H3,(H2,10,15)/b7-6+,12-11+ |
| InChIKey | CGKCWTIVGSDLRW-PHFMIZANSA-N |
| XLogP | 1.29 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(carbamoyldiazenyl)-N,N-diethylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(carbamoyldiazenyl)-N,N-diethylbut-2-enamide?
The IUPAC name of (E)-3-(carbamoyldiazenyl)-N,N-diethylbut-2-enamide (CID 135083693) is (E)-3-(carbamoyldiazenyl)-N,N-diethylbut-2-enamide.
What is the SMILES notation for (E)-3-(carbamoyldiazenyl)-N,N-diethylbut-2-enamide?
The canonical SMILES for (E)-3-(carbamoyldiazenyl)-N,N-diethylbut-2-enamide is CCN(CC)C(=O)/C=C(C)/N=N/C(N)=O.
What is the InChIKey of (E)-3-(carbamoyldiazenyl)-N,N-diethylbut-2-enamide?
The InChIKey is CGKCWTIVGSDLRW-PHFMIZANSA-N. The full InChI is InChI=1S/C9H16N4O2/c1-4-13(5-2)8(14)6-7(3)11-12-9(10)15/h6H,4-5H2,1-3H3,(H2,10,15)/b7-6+,12-11+.
What are the key properties of (E)-3-(carbamoyldiazenyl)-N,N-diethylbut-2-enamide?
(E)-3-(carbamoyldiazenyl)-N,N-diethylbut-2-enamide has a molecular weight of 212.25 g/mol, XLogP of 1.29, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(carbamoyldiazenyl)-N,N-diethylbut-2-enamide is sourced from PubChem (CID 135083693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).