C14H26O3 — CID 135083859
(4S,6S)-4-hexyl-2,2,4,6-tetramethyl-1,3-dioxan-5-one (PubChem CID 135083859) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is (4S,6S)-4-hexyl-2,2,4,6-tetramethyl-1,3-dioxan-5-one.
| Compound Name | (4S,6S)-4-hexyl-2,2,4,6-tetramethyl-1,3-dioxan-5-one |
|---|---|
| PubChem CID | 135083859 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | (4S,6S)-4-hexyl-2,2,4,6-tetramethyl-1,3-dioxan-5-one |
| SMILES | CCCCCC[C@]1(C)OC(C)(C)O[C@@H](C)C1=O |
| InChI | InChI=1S/C14H26O3/c1-6-7-8-9-10-14(5)12(15)11(2)16-13(3,4)17-14/h11H,6-10H2,1-5H3/t11-,14-/m0/s1 |
| InChIKey | PXZDLKUWQKMSOP-FZMZJTMJSA-N |
| XLogP | 3.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|