About dimethyl-penta-1,4-dien-3-yloxy-prop-2-enylsilane
dimethyl-penta-1,4-dien-3-yloxy-prop-2-enylsilane (PubChem CID 135084075) has the molecular formula C10H18OSi
and a molecular weight of 182.34 g/mol. Its IUPAC name is dimethyl-penta-1,4-dien-3-yloxy-prop-2-enylsilane.
Molecular Properties
| Compound Name | dimethyl-penta-1,4-dien-3-yloxy-prop-2-enylsilane |
| PubChem CID | 135084075 |
| Molecular Formula | C10H18OSi |
| Molecular Weight | 182.34 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | dimethyl-penta-1,4-dien-3-yloxy-prop-2-enylsilane |
| SMILES | C=CC[Si](C)(C)OC(C=C)C=C |
| InChI | InChI=1S/C10H18OSi/c1-6-9-12(4,5)11-10(7-2)8-3/h6-8,10H,1-3,9H2,4-5H3 |
| InChIKey | OWWWJABWCYLZCO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-penta-1,4-dien-3-yloxy-prop-2-enylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-penta-1,4-dien-3-yloxy-prop-2-enylsilane?
The IUPAC name of dimethyl-penta-1,4-dien-3-yloxy-prop-2-enylsilane (CID 135084075) is dimethyl-penta-1,4-dien-3-yloxy-prop-2-enylsilane.
What is the SMILES notation for dimethyl-penta-1,4-dien-3-yloxy-prop-2-enylsilane?
The canonical SMILES for dimethyl-penta-1,4-dien-3-yloxy-prop-2-enylsilane is C=CC[Si](C)(C)OC(C=C)C=C.
What is the InChIKey of dimethyl-penta-1,4-dien-3-yloxy-prop-2-enylsilane?
The InChIKey is OWWWJABWCYLZCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18OSi/c1-6-9-12(4,5)11-10(7-2)8-3/h6-8,10H,1-3,9H2,4-5H3.
What are the key properties of dimethyl-penta-1,4-dien-3-yloxy-prop-2-enylsilane?
dimethyl-penta-1,4-dien-3-yloxy-prop-2-enylsilane has a molecular weight of 182.34 g/mol, XLogP of 3.13, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-penta-1,4-dien-3-yloxy-prop-2-enylsilane is sourced from PubChem (CID 135084075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).