C13H24O — CID 135084237
(1S,2S,3R)-1-butyl-2-(methoxymethyl)-1-methyl-3-prop-2-enylcyclopropane (PubChem CID 135084237) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (1S,2S,3R)-1-butyl-2-(methoxymethyl)-1-methyl-3-prop-2-enylcyclopropane.
| Compound Name | (1S,2S,3R)-1-butyl-2-(methoxymethyl)-1-methyl-3-prop-2-enylcyclopropane |
|---|---|
| PubChem CID | 135084237 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (1S,2S,3R)-1-butyl-2-(methoxymethyl)-1-methyl-3-prop-2-enylcyclopropane |
| SMILES | C=CC[C@@H]1[C@H](COC)[C@@]1(C)CCCC |
| InChI | InChI=1S/C13H24O/c1-5-7-9-13(3)11(8-6-2)12(13)10-14-4/h6,11-12H,2,5,7-10H2,1,3-4H3/t11-,12+,13+/m1/s1 |
| InChIKey | APEVFLPIVXOJHH-AGIUHOORSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|