About [(1R,2E)-2-ethylidene-1-methylcyclopropyl]methylbenzene
[(1R,2E)-2-ethylidene-1-methylcyclopropyl]methylbenzene (PubChem CID 135084317) has the molecular formula C13H16
and a molecular weight of 172.27 g/mol. Its IUPAC name is [(1R,2E)-2-ethylidene-1-methylcyclopropyl]methylbenzene.
Molecular Properties
| Compound Name | [(1R,2E)-2-ethylidene-1-methylcyclopropyl]methylbenzene |
| PubChem CID | 135084317 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | [(1R,2E)-2-ethylidene-1-methylcyclopropyl]methylbenzene |
| SMILES | C/C=C1\C[C@]1(C)Cc1ccccc1 |
| InChI | InChI=1S/C13H16/c1-3-12-10-13(12,2)9-11-7-5-4-6-8-11/h3-8H,9-10H2,1-2H3/b12-3+/t13-/m0/s1 |
| InChIKey | DNTMUSLGAMJZPQ-QQFGACLNSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2E)-2-ethylidene-1-methylcyclopropyl]methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2E)-2-ethylidene-1-methylcyclopropyl]methylbenzene?
The IUPAC name of [(1R,2E)-2-ethylidene-1-methylcyclopropyl]methylbenzene (CID 135084317) is [(1R,2E)-2-ethylidene-1-methylcyclopropyl]methylbenzene.
What is the SMILES notation for [(1R,2E)-2-ethylidene-1-methylcyclopropyl]methylbenzene?
The canonical SMILES for [(1R,2E)-2-ethylidene-1-methylcyclopropyl]methylbenzene is C/C=C1\C[C@]1(C)Cc1ccccc1.
What is the InChIKey of [(1R,2E)-2-ethylidene-1-methylcyclopropyl]methylbenzene?
The InChIKey is DNTMUSLGAMJZPQ-QQFGACLNSA-N. The full InChI is InChI=1S/C13H16/c1-3-12-10-13(12,2)9-11-7-5-4-6-8-11/h3-8H,9-10H2,1-2H3/b12-3+/t13-/m0/s1.
What are the key properties of [(1R,2E)-2-ethylidene-1-methylcyclopropyl]methylbenzene?
[(1R,2E)-2-ethylidene-1-methylcyclopropyl]methylbenzene has a molecular weight of 172.27 g/mol, XLogP of 3.59, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2E)-2-ethylidene-1-methylcyclopropyl]methylbenzene is sourced from PubChem (CID 135084317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).