C9H18BBrO2Zn — CID 135084480
bromozinc(1+);4,4,5,5-tetramethyl-2-propyl-1,3,2-dioxaborolane (PubChem CID 135084480) has the molecular formula C9H18BBrO2Zn and a molecular weight of 314.35 g/mol. Its IUPAC name is bromozinc(1+);4,4,5,5-tetramethyl-2-propyl-1,3,2-dioxaborolane.
| Compound Name | bromozinc(1+);4,4,5,5-tetramethyl-2-propyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 135084480 |
| Molecular Formula | C9H18BBrO2Zn |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | bromozinc(1+);4,4,5,5-tetramethyl-2-propyl-1,3,2-dioxaborolane |
| SMILES | [CH2-]CCB1OC(C)(C)C(C)(C)O1.[Zn+]Br |
| InChI | InChI=1S/C9H18BO2.BrH.Zn/c1-6-7-10-11-8(2,3)9(4,5)12-10;;/h1,6-7H2,2-5H3;1H;/q-1;;+2/p-1 |
| InChIKey | XQQHREPZGCMUTC-UHFFFAOYSA-M |
| XLogP | 3.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|