C12H14N2O2 — CID 135084485
(1-methylindol-5-yl) N,N-dimethylcarbamate (PubChem CID 135084485) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is (1-methylindol-5-yl) N,N-dimethylcarbamate.
| Compound Name | (1-methylindol-5-yl) N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 135084485 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (1-methylindol-5-yl) N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1ccc2c(ccn2C)c1 |
| InChI | InChI=1S/C12H14N2O2/c1-13(2)12(15)16-10-4-5-11-9(8-10)6-7-14(11)3/h4-8H,1-3H3 |
| InChIKey | DHLHSFOVNYBHAA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |