About chlorogold;2,5,8-trimethyl-3H-imidazo[1,5-a]pyridin-3-ide
chlorogold;2,5,8-trimethyl-3H-imidazo[1,5-a]pyridin-3-ide (PubChem CID 135084748) has the molecular formula C10H13AuClN2-
and a molecular weight of 393.65 g/mol. Its IUPAC name is chlorogold;2,5,8-trimethyl-3H-imidazo[1,5-a]pyridin-3-ide.
Molecular Properties
| Compound Name | chlorogold;2,5,8-trimethyl-3H-imidazo[1,5-a]pyridin-3-ide |
| PubChem CID | 135084748 |
| Molecular Formula | C10H13AuClN2- |
| Molecular Weight | 393.65 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | chlorogold;2,5,8-trimethyl-3H-imidazo[1,5-a]pyridin-3-ide |
| SMILES | CC1=CC=C(C)N2[CH-]N(C)C=C12.Cl[Au] |
| InChI | InChI=1S/C10H13N2.Au.ClH/c1-8-4-5-9(2)12-7-11(3)6-10(8)12;;/h4-7H,1-3H3;;1H/q-1;+1;/p-1 |
| InChIKey | LCEMBKLRMNQOEV-UHFFFAOYSA-M |
| XLogP | 2.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.65 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chlorogold;2,5,8-trimethyl-3H-imidazo[1,5-a]pyridin-3-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorogold;2,5,8-trimethyl-3H-imidazo[1,5-a]pyridin-3-ide?
The IUPAC name of chlorogold;2,5,8-trimethyl-3H-imidazo[1,5-a]pyridin-3-ide (CID 135084748) is chlorogold;2,5,8-trimethyl-3H-imidazo[1,5-a]pyridin-3-ide.
What is the SMILES notation for chlorogold;2,5,8-trimethyl-3H-imidazo[1,5-a]pyridin-3-ide?
The canonical SMILES for chlorogold;2,5,8-trimethyl-3H-imidazo[1,5-a]pyridin-3-ide is CC1=CC=C(C)N2[CH-]N(C)C=C12.Cl[Au].
What is the InChIKey of chlorogold;2,5,8-trimethyl-3H-imidazo[1,5-a]pyridin-3-ide?
The InChIKey is LCEMBKLRMNQOEV-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H13N2.Au.ClH/c1-8-4-5-9(2)12-7-11(3)6-10(8)12;;/h4-7H,1-3H3;;1H/q-1;+1;/p-1.
What are the key properties of chlorogold;2,5,8-trimethyl-3H-imidazo[1,5-a]pyridin-3-ide?
chlorogold;2,5,8-trimethyl-3H-imidazo[1,5-a]pyridin-3-ide has a molecular weight of 393.65 g/mol, XLogP of 2.75, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chlorogold;2,5,8-trimethyl-3H-imidazo[1,5-a]pyridin-3-ide is sourced from PubChem (CID 135084748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).