C44H29F4N2OP — CID 135085143
[(4S,5S)-2-[2-bis(3,5-difluorophenyl)phosphanylphenyl]-4,5-diphenyl-4,5-dihydroimidazol-1-yl]-naphthalen-2-ylmethanone (PubChem CID 135085143) has the molecular formula C44H29F4N2OP and a molecular weight of 708.70 g/mol. Its IUPAC name is [(4S,5S)-2-[2-bis(3,5-difluorophenyl)phosphanylphenyl]-4,5-diphenyl-4,5-dihydroimidazol-1-yl]-naphthalen-2-ylmethanone.
| Compound Name | [(4S,5S)-2-[2-bis(3,5-difluorophenyl)phosphanylphenyl]-4,5-diphenyl-4,5-dihydroimidazol-1-yl]-naphthalen-2-ylmethanone |
|---|---|
| PubChem CID | 135085143 |
| Molecular Formula | C44H29F4N2OP |
| Molecular Weight | 708.70 g/mol |
| Exact Mass | 708.20 |
| IUPAC Name | [(4S,5S)-2-[2-bis(3,5-difluorophenyl)phosphanylphenyl]-4,5-diphenyl-4,5-dihydroimidazol-1-yl]-naphthalen-2-ylmethanone |
| SMILES | O=C(c1ccc2ccccc2c1)N1C(c2ccccc2P(c2cc(F)cc(F)c2)c2cc(F)cc(F)c2)=N[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C44H29F4N2OP/c45-33-22-34(46)25-37(24-33)52(38-26-35(47)23-36(48)27-38)40-18-10-9-17-39(40)43-49-41(29-12-3-1-4-13-29)42(30-14-5-2-6-15-30)50(43)44(51)32-20-19-28-11-7-8-16-31(28)21-32/h1-27,41-42H/t41-,42-/m0/s1 |
| InChIKey | HEEYTTOSSASMOS-COCZKOEFSA-N |
| XLogP | 9.54 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.70 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|