C30H31F6N2O2+ — CID 135085460
4-[(S)-[1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-methoxymethyl]-6-methoxyquinoline (PubChem CID 135085460) has the molecular formula C30H31F6N2O2+ and a molecular weight of 565.58 g/mol. Its IUPAC name is 4-[(S)-[1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-methoxymethyl]-6-methoxyquinoline.
| Compound Name | 4-[(S)-[1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-methoxymethyl]-6-methoxyquinoline |
|---|---|
| PubChem CID | 135085460 |
| Molecular Formula | C30H31F6N2O2+ |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | 4-[(S)-[1-[[2,5-bis(trifluoromethyl)phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-methoxymethyl]-6-methoxyquinoline |
| SMILES | C=CC1C[N+]2(Cc3cc(C(F)(F)F)ccc3C(F)(F)F)CCC1CC2[C@@H](OC)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C30H31F6N2O2/c1-4-18-16-38(17-20-13-21(29(31,32)33)5-7-25(20)30(34,35)36)12-10-19(18)14-27(38)28(40-3)23-9-11-37-26-8-6-22(39-2)15-24(23)26/h4-9,11,13,15,18-19,27-28H,1,10,12,14,16-17H2,2-3H3/q+1/t18?,19?,27?,28-,38?/m0/s1 |
| InChIKey | SHRBEDFLAOZTES-XZTVBFDDSA-N |
| XLogP | 7.58 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|