C29H31NO4 — CID 135085652
tert-butyl N-formyl-N-(1-trityloxybut-3-en-2-yl)carbamate (PubChem CID 135085652) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is tert-butyl N-formyl-N-(1-trityloxybut-3-en-2-yl)carbamate.
| Compound Name | tert-butyl N-formyl-N-(1-trityloxybut-3-en-2-yl)carbamate |
|---|---|
| PubChem CID | 135085652 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | tert-butyl N-formyl-N-(1-trityloxybut-3-en-2-yl)carbamate |
| SMILES | C=CC(COC(c1ccccc1)(c1ccccc1)c1ccccc1)N(C=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H31NO4/c1-5-26(30(22-31)27(32)34-28(2,3)4)21-33-29(23-15-9-6-10-16-23,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h5-20,22,26H,1,21H2,2-4H3 |
| InChIKey | SEJPLVYJQXESBN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|